C10H17ClN8 — CID 105230485
2-[4-chloro-5-[hydrazinyl(1H-1,2,4-triazol-5-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 105230485) has the molecular formula C10H17ClN8 and a molecular weight of 284.75 g/mol. Its IUPAC name is 2-[4-chloro-5-[hydrazinyl(1H-1,2,4-triazol-5-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-chloro-5-[hydrazinyl(1H-1,2,4-triazol-5-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105230485 |
| Molecular Formula | C10H17ClN8 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[4-chloro-5-[hydrazinyl(1H-1,2,4-triazol-5-yl)methyl]pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ncc(Cl)c1C(NN)c1ncn[nH]1 |
| InChI | InChI=1S/C10H17ClN8/c1-18(2)3-4-19-9(7(11)5-15-19)8(16-12)10-13-6-14-17-10/h5-6,8,16H,3-4,12H2,1-2H3,(H,13,14,17) |
| InChIKey | VOQHACCSWNWTMW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|