C19H26O7S — CID 10524919
[(3aS,4S,6R,6aR)-2,2-dimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methyl acetate (PubChem CID 10524919) has the molecular formula C19H26O7S and a molecular weight of 398.48 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-2,2-dimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methyl acetate.
| Compound Name | [(3aS,4S,6R,6aR)-2,2-dimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 10524919 |
| Molecular Formula | C19H26O7S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [(3aS,4S,6R,6aR)-2,2-dimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H26O7S/c1-12-5-7-16(8-6-12)27(21,22)24-11-15-9-14(10-23-13(2)20)17-18(15)26-19(3,4)25-17/h5-8,14-15,17-18H,9-11H2,1-4H3/t14-,15+,17-,18+/m1/s1 |
| InChIKey | NCLKPBVWFYBQEN-ATLSCFEFSA-N |
| XLogP | 2.42 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|