C11H14F4N2 — CID 105250213
1-[2-fluoro-5-(trifluoromethyl)phenyl]butylhydrazine (PubChem CID 105250213) has the molecular formula C11H14F4N2 and a molecular weight of 250.24 g/mol. Its IUPAC name is 1-[2-fluoro-5-(trifluoromethyl)phenyl]butylhydrazine.
| Compound Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]butylhydrazine |
|---|---|
| PubChem CID | 105250213 |
| Molecular Formula | C11H14F4N2 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]butylhydrazine |
| SMILES | CCCC(NN)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H14F4N2/c1-2-3-10(17-16)8-6-7(11(13,14)15)4-5-9(8)12/h4-6,10,17H,2-3,16H2,1H3 |
| InChIKey | JBUHGDPQPSSELP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|