C11H12BrFN4 — CID 105252067
[2-(2-bromo-3-fluorophenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine (PubChem CID 105252067) has the molecular formula C11H12BrFN4 and a molecular weight of 299.15 g/mol. Its IUPAC name is [2-(2-bromo-3-fluorophenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2-bromo-3-fluorophenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105252067 |
| Molecular Formula | C11H12BrFN4 |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | [2-(2-bromo-3-fluorophenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cccc(F)c1Br)c1ncc[nH]1 |
| InChI | InChI=1S/C11H12BrFN4/c12-10-7(2-1-3-8(10)13)6-9(17-14)11-15-4-5-16-11/h1-5,9,17H,6,14H2,(H,15,16) |
| InChIKey | ISXHDZCVZLTYJL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|