C13H18N4 — CID 105252049
[2-(2,5-dimethylphenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine (PubChem CID 105252049) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2,5-dimethylphenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105252049 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine |
| SMILES | Cc1ccc(C)c(CC(NN)c2ncc[nH]2)c1 |
| InChI | InChI=1S/C13H18N4/c1-9-3-4-10(2)11(7-9)8-12(17-14)13-15-5-6-16-13/h3-7,12,17H,8,14H2,1-2H3,(H,15,16) |
| InChIKey | OWMXRSUAOUXCGJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|