C11H13BrN4 — CID 105252268
[2-(4-bromophenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine (PubChem CID 105252268) has the molecular formula C11H13BrN4 and a molecular weight of 281.16 g/mol. Its IUPAC name is [2-(4-bromophenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromophenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105252268 |
| Molecular Formula | C11H13BrN4 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | [2-(4-bromophenyl)-1-(1H-imidazol-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Br)cc1)c1ncc[nH]1 |
| InChI | InChI=1S/C11H13BrN4/c12-9-3-1-8(2-4-9)7-10(16-13)11-14-5-6-15-11/h1-6,10,16H,7,13H2,(H,14,15) |
| InChIKey | PQZVVBCXDMZHNS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|