C11H13N3S — CID 105253666
[(4-methylphenyl)-(1,3-thiazol-5-yl)methyl]hydrazine (PubChem CID 105253666) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is [(4-methylphenyl)-(1,3-thiazol-5-yl)methyl]hydrazine.
| Compound Name | [(4-methylphenyl)-(1,3-thiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105253666 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | [(4-methylphenyl)-(1,3-thiazol-5-yl)methyl]hydrazine |
| SMILES | Cc1ccc(C(NN)c2cncs2)cc1 |
| InChI | InChI=1S/C11H13N3S/c1-8-2-4-9(5-3-8)11(14-12)10-6-13-7-15-10/h2-7,11,14H,12H2,1H3 |
| InChIKey | FRIBKDJOORPFFP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|