C19H27NO7S — CID 10525786
methyl (2S,3S,3aR)-2-[(1S)-1-methylsulfonyloxy-3-phenylmethoxypropyl]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate (PubChem CID 10525786) has the molecular formula C19H27NO7S and a molecular weight of 413.49 g/mol. Its IUPAC name is methyl (2S,3S,3aR)-2-[(1S)-1-methylsulfonyloxy-3-phenylmethoxypropyl]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate.
| Compound Name | methyl (2S,3S,3aR)-2-[(1S)-1-methylsulfonyloxy-3-phenylmethoxypropyl]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 10525786 |
| Molecular Formula | C19H27NO7S |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | methyl (2S,3S,3aR)-2-[(1S)-1-methylsulfonyloxy-3-phenylmethoxypropyl]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]([C@H](CCOCc2ccccc2)OS(C)(=O)=O)ON2CCC[C@H]12 |
| InChI | InChI=1S/C19H27NO7S/c1-24-19(21)17-15-9-6-11-20(15)26-18(17)16(27-28(2,22)23)10-12-25-13-14-7-4-3-5-8-14/h3-5,7-8,15-18H,6,9-13H2,1-2H3/t15-,16+,17+,18-/m1/s1 |
| InChIKey | MALCJMAXMDOPAB-VSZNYVQBSA-N |
| XLogP | 1.51 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|