C20H29NO7S — CID 10502598
methyl (2R,3R,3aR)-2-[(1R)-1-methylsulfonyloxy-3-phenylmethoxypropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate (PubChem CID 10502598) has the molecular formula C20H29NO7S and a molecular weight of 427.52 g/mol. Its IUPAC name is methyl (2R,3R,3aR)-2-[(1R)-1-methylsulfonyloxy-3-phenylmethoxypropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate.
| Compound Name | methyl (2R,3R,3aR)-2-[(1R)-1-methylsulfonyloxy-3-phenylmethoxypropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10502598 |
| Molecular Formula | C20H29NO7S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | methyl (2R,3R,3aR)-2-[(1R)-1-methylsulfonyloxy-3-phenylmethoxypropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]([C@@H](CCOCc2ccccc2)OS(C)(=O)=O)ON2CCCC[C@H]12 |
| InChI | InChI=1S/C20H29NO7S/c1-25-20(22)18-16-10-6-7-12-21(16)27-19(18)17(28-29(2,23)24)11-13-26-14-15-8-4-3-5-9-15/h3-5,8-9,16-19H,6-7,10-14H2,1-2H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | IOSXITRFGONYKJ-MKXGPGLRSA-N |
| XLogP | 1.90 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|