C19H27NO5 — CID 10712772
methyl (2S,3S,3aR)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate (PubChem CID 10712772) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl (2S,3S,3aR)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate.
| Compound Name | methyl (2S,3S,3aR)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10712772 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | methyl (2S,3S,3aR)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]([C@H](O)CCOCc2ccccc2)ON2CCCC[C@H]12 |
| InChI | InChI=1S/C19H27NO5/c1-23-19(22)17-15-9-5-6-11-20(15)25-18(17)16(21)10-12-24-13-14-7-3-2-4-8-14/h2-4,7-8,15-18,21H,5-6,9-13H2,1H3/t15-,16-,17+,18-/m1/s1 |
| InChIKey | YSLGYJXZUICFEU-ZJPYXAASSA-N |
| XLogP | 1.91 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|