C18H25NO4 — CID 11415923
(3R,4S)-4-hydroxy-5-(2-phenylmethoxyethyl)-3-[(2R)-piperidin-2-yl]oxolan-2-one (PubChem CID 11415923) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (3R,4S)-4-hydroxy-5-(2-phenylmethoxyethyl)-3-[(2R)-piperidin-2-yl]oxolan-2-one.
| Compound Name | (3R,4S)-4-hydroxy-5-(2-phenylmethoxyethyl)-3-[(2R)-piperidin-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 11415923 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (3R,4S)-4-hydroxy-5-(2-phenylmethoxyethyl)-3-[(2R)-piperidin-2-yl]oxolan-2-one |
| SMILES | O=C1OC(CCOCc2ccccc2)[C@@H](O)[C@H]1[C@H]1CCCCN1 |
| InChI | InChI=1S/C18H25NO4/c20-17-15(9-11-22-12-13-6-2-1-3-7-13)23-18(21)16(17)14-8-4-5-10-19-14/h1-3,6-7,14-17,19-20H,4-5,8-12H2/t14-,15?,16-,17-/m1/s1 |
| InChIKey | WXYJFQSOMHLPMP-FNAUVDMUSA-N |
| XLogP | 1.64 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|