C24H29NO8 — CID 163630257
2,3-dihydroxybutanedioic acid;2-(2,2-diphenyl-1,3-dioxolan-4-yl)piperidine (PubChem CID 163630257) has the molecular formula C24H29NO8 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;2-(2,2-diphenyl-1,3-dioxolan-4-yl)piperidine.
| Compound Name | 2,3-dihydroxybutanedioic acid;2-(2,2-diphenyl-1,3-dioxolan-4-yl)piperidine |
|---|---|
| PubChem CID | 163630257 |
| Molecular Formula | C24H29NO8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;2-(2,2-diphenyl-1,3-dioxolan-4-yl)piperidine |
| SMILES | O=C(O)C(O)C(O)C(=O)O.c1ccc(C2(c3ccccc3)OCC(C3CCCCN3)O2)cc1 |
| InChI | InChI=1S/C20H23NO2.C4H6O6/c1-3-9-16(10-4-1)20(17-11-5-2-6-12-17)22-15-19(23-20)18-13-7-8-14-21-18;5-1(3(7)8)2(6)4(9)10/h1-6,9-12,18-19,21H,7-8,13-15H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | HVMDFUDHVSVCIG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |