C20H23NO3 — CID 90667069
(2S,4S)-2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]piperidin-4-ol (PubChem CID 90667069) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2S,4S)-2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]piperidin-4-ol.
| Compound Name | (2S,4S)-2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 90667069 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (2S,4S)-2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]piperidin-4-ol |
| SMILES | O[C@H]1CCN[C@H]([C@@H]2COC(c3ccccc3)(c3ccccc3)O2)C1 |
| InChI | InChI=1S/C20H23NO3/c22-17-11-12-21-18(13-17)19-14-23-20(24-19,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-19,21-22H,11-14H2/t17-,18-,19-/m0/s1 |
| InChIKey | HKIWVNOCBNBVAO-FHWLQOOXSA-N |
| XLogP | 2.42 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |