C17H20FNO5 — CID 134934779
[(1S,6R,7S,8R,8aR)-6-fluoro-7-hydroxy-5-oxo-8-phenylmethoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-1-yl] acetate (PubChem CID 134934779) has the molecular formula C17H20FNO5 and a molecular weight of 337.35 g/mol. Its IUPAC name is [(1S,6R,7S,8R,8aR)-6-fluoro-7-hydroxy-5-oxo-8-phenylmethoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-1-yl] acetate.
| Compound Name | [(1S,6R,7S,8R,8aR)-6-fluoro-7-hydroxy-5-oxo-8-phenylmethoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-1-yl] acetate |
|---|---|
| PubChem CID | 134934779 |
| Molecular Formula | C17H20FNO5 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [(1S,6R,7S,8R,8aR)-6-fluoro-7-hydroxy-5-oxo-8-phenylmethoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCN2C(=O)[C@H](F)[C@@H](O)[C@H](OCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C17H20FNO5/c1-10(20)24-12-7-8-19-14(12)16(15(21)13(18)17(19)22)23-9-11-5-3-2-4-6-11/h2-6,12-16,21H,7-9H2,1H3/t12-,13+,14+,15+,16+/m0/s1 |
| InChIKey | UNKWWVHDPPSBRH-UYJHQMFVSA-N |
| XLogP | 0.82 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |