C23H25F2NO4 — CID 71505942
(1R,2R,7S,8aR)-8,8-difluoro-8a-hydroxy-7-methyl-1,2-bis(phenylmethoxy)-2,5,6,7-tetrahydro-1H-indolizin-3-one (PubChem CID 71505942) has the molecular formula C23H25F2NO4 and a molecular weight of 417.45 g/mol. Its IUPAC name is (1R,2R,7S,8aR)-8,8-difluoro-8a-hydroxy-7-methyl-1,2-bis(phenylmethoxy)-2,5,6,7-tetrahydro-1H-indolizin-3-one.
| Compound Name | (1R,2R,7S,8aR)-8,8-difluoro-8a-hydroxy-7-methyl-1,2-bis(phenylmethoxy)-2,5,6,7-tetrahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 71505942 |
| Molecular Formula | C23H25F2NO4 |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (1R,2R,7S,8aR)-8,8-difluoro-8a-hydroxy-7-methyl-1,2-bis(phenylmethoxy)-2,5,6,7-tetrahydro-1H-indolizin-3-one |
| SMILES | C[C@H]1CCN2C(=O)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@]2(O)C1(F)F |
| InChI | InChI=1S/C23H25F2NO4/c1-16-12-13-26-21(27)19(29-14-17-8-4-2-5-9-17)20(23(26,28)22(16,24)25)30-15-18-10-6-3-7-11-18/h2-11,16,19-20,28H,12-15H2,1H3/t16-,19+,20+,23+/m0/s1 |
| InChIKey | GLYDBGQQZKFQIP-FDSZKQNJSA-N |
| XLogP | 3.36 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |