C22H23F2NO4 — CID 71505798
(1R,2R,6R,8R)-7,7-difluoro-8-hydroxy-6-methyl-1,2-bis(phenylmethoxy)-1,2,5,6-tetrahydropyrrolizin-3-one (PubChem CID 71505798) has the molecular formula C22H23F2NO4 and a molecular weight of 403.43 g/mol. Its IUPAC name is (1R,2R,6R,8R)-7,7-difluoro-8-hydroxy-6-methyl-1,2-bis(phenylmethoxy)-1,2,5,6-tetrahydropyrrolizin-3-one.
| Compound Name | (1R,2R,6R,8R)-7,7-difluoro-8-hydroxy-6-methyl-1,2-bis(phenylmethoxy)-1,2,5,6-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 71505798 |
| Molecular Formula | C22H23F2NO4 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (1R,2R,6R,8R)-7,7-difluoro-8-hydroxy-6-methyl-1,2-bis(phenylmethoxy)-1,2,5,6-tetrahydropyrrolizin-3-one |
| SMILES | C[C@@H]1CN2C(=O)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@]2(O)C1(F)F |
| InChI | InChI=1S/C22H23F2NO4/c1-15-12-25-20(26)18(28-13-16-8-4-2-5-9-16)19(22(25,27)21(15,23)24)29-14-17-10-6-3-7-11-17/h2-11,15,18-19,27H,12-14H2,1H3/t15-,18-,19-,22-/m1/s1 |
| InChIKey | JXSZHXOADQQYKQ-CIVUBGFFSA-N |
| XLogP | 2.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |