C22H23F2NO3 — CID 71505448
(1S,2R,6R,8R)-7,7-difluoro-6-methyl-1,2-bis(phenylmethoxy)-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 71505448) has the molecular formula C22H23F2NO3 and a molecular weight of 387.43 g/mol. Its IUPAC name is (1S,2R,6R,8R)-7,7-difluoro-6-methyl-1,2-bis(phenylmethoxy)-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (1S,2R,6R,8R)-7,7-difluoro-6-methyl-1,2-bis(phenylmethoxy)-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 71505448 |
| Molecular Formula | C22H23F2NO3 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (1S,2R,6R,8R)-7,7-difluoro-6-methyl-1,2-bis(phenylmethoxy)-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C[C@@H]1CN2C(=O)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2C1(F)F |
| InChI | InChI=1S/C22H23F2NO3/c1-15-12-25-20(22(15,23)24)18(27-13-16-8-4-2-5-9-16)19(21(25)26)28-14-17-10-6-3-7-11-17/h2-11,15,18-20H,12-14H2,1H3/t15-,18-,19-,20-/m1/s1 |
| InChIKey | NLMMMEYUXBLXOD-HUYLIWGRSA-N |
| XLogP | 3.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |