C23H25F2NO3 — CID 71506138
(1S,2R,7S,8aS)-8,8-difluoro-7-methyl-1,2-bis(phenylmethoxy)-1,2,5,6,7,8a-hexahydroindolizin-3-one (PubChem CID 71506138) has the molecular formula C23H25F2NO3 and a molecular weight of 401.45 g/mol. Its IUPAC name is (1S,2R,7S,8aS)-8,8-difluoro-7-methyl-1,2-bis(phenylmethoxy)-1,2,5,6,7,8a-hexahydroindolizin-3-one.
| Compound Name | (1S,2R,7S,8aS)-8,8-difluoro-7-methyl-1,2-bis(phenylmethoxy)-1,2,5,6,7,8a-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 71506138 |
| Molecular Formula | C23H25F2NO3 |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (1S,2R,7S,8aS)-8,8-difluoro-7-methyl-1,2-bis(phenylmethoxy)-1,2,5,6,7,8a-hexahydroindolizin-3-one |
| SMILES | C[C@H]1CCN2C(=O)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2C1(F)F |
| InChI | InChI=1S/C23H25F2NO3/c1-16-12-13-26-21(23(16,24)25)19(28-14-17-8-4-2-5-9-17)20(22(26)27)29-15-18-10-6-3-7-11-18/h2-11,16,19-21H,12-15H2,1H3/t16-,19+,20+,21-/m0/s1 |
| InChIKey | BHSYXSNCCSCDCR-ZXNZYJFHSA-N |
| XLogP | 4.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |