C16H18FN3 — CID 105257937
[(4-cyclobutylphenyl)-(3-fluoro-2-pyridinyl)methyl]hydrazine (PubChem CID 105257937) has the molecular formula C16H18FN3 and a molecular weight of 271.34 g/mol. Its IUPAC name is [(4-cyclobutylphenyl)-(3-fluoro-2-pyridinyl)methyl]hydrazine.
| Compound Name | [(4-cyclobutylphenyl)-(3-fluoro-2-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105257937 |
| Molecular Formula | C16H18FN3 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | [(4-cyclobutylphenyl)-(3-fluoro-2-pyridinyl)methyl]hydrazine |
| SMILES | NNC(c1ccc(C2CCC2)cc1)c1ncccc1F |
| InChI | InChI=1S/C16H18FN3/c17-14-5-2-10-19-16(14)15(20-18)13-8-6-12(7-9-13)11-3-1-4-11/h2,5-11,15,20H,1,3-4,18H2 |
| InChIKey | JFJWVOITMOPHTM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|