C11H16FN3 — CID 105257868
[2-cyclobutyl-1-(3-fluoro-2-pyridinyl)ethyl]hydrazine (PubChem CID 105257868) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is [2-cyclobutyl-1-(3-fluoro-2-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-cyclobutyl-1-(3-fluoro-2-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105257868 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | [2-cyclobutyl-1-(3-fluoro-2-pyridinyl)ethyl]hydrazine |
| SMILES | NNC(CC1CCC1)c1ncccc1F |
| InChI | InChI=1S/C11H16FN3/c12-9-5-2-6-14-11(9)10(15-13)7-8-3-1-4-8/h2,5-6,8,10,15H,1,3-4,7,13H2 |
| InChIKey | NYMDDNFGCZLHHU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|