C12H18BrN3 — CID 105267993
[1-(3-bromo-2-pyridinyl)-2-cyclopentylethyl]hydrazine (PubChem CID 105267993) has the molecular formula C12H18BrN3 and a molecular weight of 284.20 g/mol. Its IUPAC name is [1-(3-bromo-2-pyridinyl)-2-cyclopentylethyl]hydrazine.
| Compound Name | [1-(3-bromo-2-pyridinyl)-2-cyclopentylethyl]hydrazine |
|---|---|
| PubChem CID | 105267993 |
| Molecular Formula | C12H18BrN3 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | [1-(3-bromo-2-pyridinyl)-2-cyclopentylethyl]hydrazine |
| SMILES | NNC(CC1CCCC1)c1ncccc1Br |
| InChI | InChI=1S/C12H18BrN3/c13-10-6-3-7-15-12(10)11(16-14)8-9-4-1-2-5-9/h3,6-7,9,11,16H,1-2,4-5,8,14H2 |
| InChIKey | QDDXYOYFHOFZJZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|