C10H13Br2N3 — CID 105268257
[2-cyclopropyl-1-(3,5-dibromo-2-pyridinyl)ethyl]hydrazine (PubChem CID 105268257) has the molecular formula C10H13Br2N3 and a molecular weight of 335.04 g/mol. Its IUPAC name is [2-cyclopropyl-1-(3,5-dibromo-2-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-cyclopropyl-1-(3,5-dibromo-2-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105268257 |
| Molecular Formula | C10H13Br2N3 |
| Molecular Weight | 335.04 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | [2-cyclopropyl-1-(3,5-dibromo-2-pyridinyl)ethyl]hydrazine |
| SMILES | NNC(CC1CC1)c1ncc(Br)cc1Br |
| InChI | InChI=1S/C10H13Br2N3/c11-7-4-8(12)10(14-5-7)9(15-13)3-6-1-2-6/h4-6,9,15H,1-3,13H2 |
| InChIKey | TZMZAHKTRASVHW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.04 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|