C11H13Br2N5 — CID 105268547
[1-(3,5-dibromo-2-pyridinyl)-2-(1-methylimidazol-2-yl)ethyl]hydrazine (PubChem CID 105268547) has the molecular formula C11H13Br2N5 and a molecular weight of 375.07 g/mol. Its IUPAC name is [1-(3,5-dibromo-2-pyridinyl)-2-(1-methylimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(3,5-dibromo-2-pyridinyl)-2-(1-methylimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105268547 |
| Molecular Formula | C11H13Br2N5 |
| Molecular Weight | 375.07 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | [1-(3,5-dibromo-2-pyridinyl)-2-(1-methylimidazol-2-yl)ethyl]hydrazine |
| SMILES | Cn1ccnc1CC(NN)c1ncc(Br)cc1Br |
| InChI | InChI=1S/C11H13Br2N5/c1-18-3-2-15-10(18)5-9(17-14)11-8(13)4-7(12)6-16-11/h2-4,6,9,17H,5,14H2,1H3 |
| InChIKey | QJVODIPMJLTVOB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.07 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|