C13H12Br2ClN3 — CID 105268537
[2-(4-chlorophenyl)-1-(3,5-dibromo-2-pyridinyl)ethyl]hydrazine (PubChem CID 105268537) has the molecular formula C13H12Br2ClN3 and a molecular weight of 405.52 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1-(3,5-dibromo-2-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(4-chlorophenyl)-1-(3,5-dibromo-2-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105268537 |
| Molecular Formula | C13H12Br2ClN3 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 402.91 |
| IUPAC Name | [2-(4-chlorophenyl)-1-(3,5-dibromo-2-pyridinyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)cc1)c1ncc(Br)cc1Br |
| InChI | InChI=1S/C13H12Br2ClN3/c14-9-6-11(15)13(18-7-9)12(19-17)5-8-1-3-10(16)4-2-8/h1-4,6-7,12,19H,5,17H2 |
| InChIKey | OTYZWGFAMFLRTB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|