C10H18N4O3S — CID 105258954
[(1,1-dioxothiolan-3-yl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]hydrazine (PubChem CID 105258954) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is [(1,1-dioxothiolan-3-yl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]hydrazine.
| Compound Name | [(1,1-dioxothiolan-3-yl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105258954 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [(1,1-dioxothiolan-3-yl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]hydrazine |
| SMILES | COc1cnn(C)c1C(NN)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N4O3S/c1-14-10(8(17-2)5-12-14)9(13-11)7-3-4-18(15,16)6-7/h5,7,9,13H,3-4,6,11H2,1-2H3 |
| InChIKey | LXPLMESYKYMBCC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|