C11H19BrN4O3S — CID 105258995
[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(1,1-dioxothiolan-3-yl)methyl]hydrazine (PubChem CID 105258995) has the molecular formula C11H19BrN4O3S and a molecular weight of 367.27 g/mol. Its IUPAC name is [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(1,1-dioxothiolan-3-yl)methyl]hydrazine.
| Compound Name | [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(1,1-dioxothiolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105258995 |
| Molecular Formula | C11H19BrN4O3S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(1,1-dioxothiolan-3-yl)methyl]hydrazine |
| SMILES | COCCn1ncc(Br)c1C(NN)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19BrN4O3S/c1-19-4-3-16-11(9(12)6-14-16)10(15-13)8-2-5-20(17,18)7-8/h6,8,10,15H,2-5,7,13H2,1H3 |
| InChIKey | IQBIPJRFNNNLAX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|