C11H19BrN4O3 — CID 105337280
[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(1,4-dioxan-2-yl)methyl]hydrazine (PubChem CID 105337280) has the molecular formula C11H19BrN4O3 and a molecular weight of 335.20 g/mol. Its IUPAC name is [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(1,4-dioxan-2-yl)methyl]hydrazine.
| Compound Name | [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(1,4-dioxan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105337280 |
| Molecular Formula | C11H19BrN4O3 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(1,4-dioxan-2-yl)methyl]hydrazine |
| SMILES | COCCn1ncc(Br)c1C(NN)C1COCCO1 |
| InChI | InChI=1S/C11H19BrN4O3/c1-17-3-2-16-11(8(12)6-14-16)10(15-13)9-7-18-4-5-19-9/h6,9-10,15H,2-5,7,13H2,1H3 |
| InChIKey | YFMYXGYPEHQFFF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|