C17H26N2S2 — CID 105259545
[1-(3-methyl-1,4-dithian-2-yl)-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine (PubChem CID 105259545) has the molecular formula C17H26N2S2 and a molecular weight of 322.54 g/mol. Its IUPAC name is [1-(3-methyl-1,4-dithian-2-yl)-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine.
| Compound Name | [1-(3-methyl-1,4-dithian-2-yl)-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105259545 |
| Molecular Formula | C17H26N2S2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [1-(3-methyl-1,4-dithian-2-yl)-2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]hydrazine |
| SMILES | CC1SCCSC1C(CC1CCCc2ccccc21)NN |
| InChI | InChI=1S/C17H26N2S2/c1-12-17(21-10-9-20-12)16(19-18)11-14-7-4-6-13-5-2-3-8-15(13)14/h2-3,5,8,12,14,16-17,19H,4,6-7,9-11,18H2,1H3 |
| InChIKey | VTOJCUKMNMTHFH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|