C13H28N4 — CID 105261240
[1-(1,4-dimethyl-1,4-diazepan-2-yl)-4-methylpent-4-enyl]hydrazine (PubChem CID 105261240) has the molecular formula C13H28N4 and a molecular weight of 240.39 g/mol. Its IUPAC name is [1-(1,4-dimethyl-1,4-diazepan-2-yl)-4-methylpent-4-enyl]hydrazine.
| Compound Name | [1-(1,4-dimethyl-1,4-diazepan-2-yl)-4-methylpent-4-enyl]hydrazine |
|---|---|
| PubChem CID | 105261240 |
| Molecular Formula | C13H28N4 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | [1-(1,4-dimethyl-1,4-diazepan-2-yl)-4-methylpent-4-enyl]hydrazine |
| SMILES | C=C(C)CCC(NN)C1CN(C)CCCN1C |
| InChI | InChI=1S/C13H28N4/c1-11(2)6-7-12(15-14)13-10-16(3)8-5-9-17(13)4/h12-13,15H,1,5-10,14H2,2-4H3 |
| InChIKey | QXIJVSMCGKGHPE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|