C10H21N3 — CID 177181516
ethane;5-methyl-2,4,6,7,8,8a-hexahydro-1H-pyrazolo[4,3-c]azepine (PubChem CID 177181516) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is ethane;5-methyl-2,4,6,7,8,8a-hexahydro-1H-pyrazolo[4,3-c]azepine.
| Compound Name | ethane;5-methyl-2,4,6,7,8,8a-hexahydro-1H-pyrazolo[4,3-c]azepine |
|---|---|
| PubChem CID | 177181516 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | ethane;5-methyl-2,4,6,7,8,8a-hexahydro-1H-pyrazolo[4,3-c]azepine |
| SMILES | CC.CN1CCCC2NNC=C2C1 |
| InChI | InChI=1S/C8H15N3.C2H6/c1-11-4-2-3-8-7(6-11)5-9-10-8;1-2/h5,8-10H,2-4,6H2,1H3;1-2H3 |
| InChIKey | YJMOMLFRJFJTIG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |