C8H15N3 — CID 177181517
5-methyl-2,4,6,7,8,8a-hexahydro-1H-pyrazolo[4,3-c]azepine (PubChem CID 177181517) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 5-methyl-2,4,6,7,8,8a-hexahydro-1H-pyrazolo[4,3-c]azepine.
| Compound Name | 5-methyl-2,4,6,7,8,8a-hexahydro-1H-pyrazolo[4,3-c]azepine |
|---|---|
| PubChem CID | 177181517 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 5-methyl-2,4,6,7,8,8a-hexahydro-1H-pyrazolo[4,3-c]azepine |
| SMILES | CN1CCCC2NNC=C2C1 |
| InChI | InChI=1S/C8H15N3/c1-11-4-2-3-8-7(6-11)5-9-10-8/h5,8-10H,2-4,6H2,1H3 |
| InChIKey | YCRTWOVMDCYYER-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |