C11H24N4 — CID 105261345
[1-(1,4-dimethyl-1,4-diazepan-2-yl)-2-methylprop-2-enyl]hydrazine (PubChem CID 105261345) has the molecular formula C11H24N4 and a molecular weight of 212.34 g/mol. Its IUPAC name is [1-(1,4-dimethyl-1,4-diazepan-2-yl)-2-methylprop-2-enyl]hydrazine.
| Compound Name | [1-(1,4-dimethyl-1,4-diazepan-2-yl)-2-methylprop-2-enyl]hydrazine |
|---|---|
| PubChem CID | 105261345 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | [1-(1,4-dimethyl-1,4-diazepan-2-yl)-2-methylprop-2-enyl]hydrazine |
| SMILES | C=C(C)C(NN)C1CN(C)CCCN1C |
| InChI | InChI=1S/C11H24N4/c1-9(2)11(13-12)10-8-14(3)6-5-7-15(10)4/h10-11,13H,1,5-8,12H2,2-4H3 |
| InChIKey | RDCINWGNJKEANF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|