C13H18N2O — CID 105262779
[cyclobutyl(2,3-dihydro-1-benzofuran-3-yl)methyl]hydrazine (PubChem CID 105262779) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is [cyclobutyl(2,3-dihydro-1-benzofuran-3-yl)methyl]hydrazine.
| Compound Name | [cyclobutyl(2,3-dihydro-1-benzofuran-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105262779 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | [cyclobutyl(2,3-dihydro-1-benzofuran-3-yl)methyl]hydrazine |
| SMILES | NNC(C1CCC1)C1COc2ccccc21 |
| InChI | InChI=1S/C13H18N2O/c14-15-13(9-4-3-5-9)11-8-16-12-7-2-1-6-10(11)12/h1-2,6-7,9,11,13,15H,3-5,8,14H2 |
| InChIKey | QVXXEJQDVLUFTI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|