C17H25NO2 — CID 107136795
N-[2,3-dihydro-1-benzofuran-3-yl(oxan-3-yl)methyl]propan-1-amine (PubChem CID 107136795) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-[2,3-dihydro-1-benzofuran-3-yl(oxan-3-yl)methyl]propan-1-amine.
| Compound Name | N-[2,3-dihydro-1-benzofuran-3-yl(oxan-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107136795 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[2,3-dihydro-1-benzofuran-3-yl(oxan-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1CCCOC1)C1COc2ccccc21 |
| InChI | InChI=1S/C17H25NO2/c1-2-9-18-17(13-6-5-10-19-11-13)15-12-20-16-8-4-3-7-14(15)16/h3-4,7-8,13,15,17-18H,2,5-6,9-12H2,1H3 |
| InChIKey | KQGIEKGSIDEGSE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |