C18H27NO2 — CID 107136469
N-[3,4-dihydro-2H-chromen-4-yl(oxan-3-yl)methyl]propan-1-amine (PubChem CID 107136469) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[3,4-dihydro-2H-chromen-4-yl(oxan-3-yl)methyl]propan-1-amine.
| Compound Name | N-[3,4-dihydro-2H-chromen-4-yl(oxan-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107136469 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-[3,4-dihydro-2H-chromen-4-yl(oxan-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1CCCOC1)C1CCOc2ccccc21 |
| InChI | InChI=1S/C18H27NO2/c1-2-10-19-18(14-6-5-11-20-13-14)16-9-12-21-17-8-4-3-7-15(16)17/h3-4,7-8,14,16,18-19H,2,5-6,9-13H2,1H3 |
| InChIKey | BDCUAWDBEACLBC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |