C15H17ClFN3O — CID 105264388
[2-(3-chloro-2-fluorophenyl)-1-(5-ethoxy-3-pyridinyl)ethyl]hydrazine (PubChem CID 105264388) has the molecular formula C15H17ClFN3O and a molecular weight of 309.77 g/mol. Its IUPAC name is [2-(3-chloro-2-fluorophenyl)-1-(5-ethoxy-3-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(3-chloro-2-fluorophenyl)-1-(5-ethoxy-3-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105264388 |
| Molecular Formula | C15H17ClFN3O |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [2-(3-chloro-2-fluorophenyl)-1-(5-ethoxy-3-pyridinyl)ethyl]hydrazine |
| SMILES | CCOc1cncc(C(Cc2cccc(Cl)c2F)NN)c1 |
| InChI | InChI=1S/C15H17ClFN3O/c1-2-21-12-6-11(8-19-9-12)14(20-18)7-10-4-3-5-13(16)15(10)17/h3-6,8-9,14,20H,2,7,18H2,1H3 |
| InChIKey | JQCHEBBLQSZWBF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|