C7H12F2N2O — CID 105264984
[1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethyl]hydrazine (PubChem CID 105264984) has the molecular formula C7H12F2N2O and a molecular weight of 178.18 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 105264984 |
| Molecular Formula | C7H12F2N2O |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-5-yl)-2,2-difluoroethyl]hydrazine |
| SMILES | NNC(C1=COCCC1)C(F)F |
| InChI | InChI=1S/C7H12F2N2O/c8-7(9)6(11-10)5-2-1-3-12-4-5/h4,6-7,11H,1-3,10H2 |
| InChIKey | RQKHCWLKBMOVGP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|