C7H8F3N3 — CID 105265116
[2,2-difluoro-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine (PubChem CID 105265116) has the molecular formula C7H8F3N3 and a molecular weight of 191.16 g/mol. Its IUPAC name is [2,2-difluoro-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine.
| Compound Name | [2,2-difluoro-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265116 |
| Molecular Formula | C7H8F3N3 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | [2,2-difluoro-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine |
| SMILES | NNC(c1ccncc1F)C(F)F |
| InChI | InChI=1S/C7H8F3N3/c8-5-3-12-2-1-4(5)6(13-11)7(9)10/h1-3,6-7,13H,11H2 |
| InChIKey | XGXCYBICRSENMG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|