C8H9F3N2 — CID 105265053
[2,2-difluoro-1-(2-fluorophenyl)ethyl]hydrazine (PubChem CID 105265053) has the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. Its IUPAC name is [2,2-difluoro-1-(2-fluorophenyl)ethyl]hydrazine.
| Compound Name | [2,2-difluoro-1-(2-fluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265053 |
| Molecular Formula | C8H9F3N2 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | [2,2-difluoro-1-(2-fluorophenyl)ethyl]hydrazine |
| SMILES | NNC(c1ccccc1F)C(F)F |
| InChI | InChI=1S/C8H9F3N2/c9-6-4-2-1-3-5(6)7(13-12)8(10)11/h1-4,7-8,13H,12H2 |
| InChIKey | GVCIQLKWAJMQQV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|