C12H19FN2 — CID 116949640
1-(2-fluorophenyl)-N,2-dimethylbutane-1,4-diamine (PubChem CID 116949640) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N,2-dimethylbutane-1,4-diamine.
| Compound Name | 1-(2-fluorophenyl)-N,2-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116949640 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-(2-fluorophenyl)-N,2-dimethylbutane-1,4-diamine |
| SMILES | CNC(c1ccccc1F)C(C)CCN |
| InChI | InChI=1S/C12H19FN2/c1-9(7-8-14)12(15-2)10-5-3-4-6-11(10)13/h3-6,9,12,15H,7-8,14H2,1-2H3 |
| InChIKey | MKSXFMABXKQYCG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |