C13H19BrFN — CID 107893716
1-(2-bromo-3-fluorophenyl)-N,2-dimethylpentan-1-amine (PubChem CID 107893716) has the molecular formula C13H19BrFN and a molecular weight of 288.20 g/mol. Its IUPAC name is 1-(2-bromo-3-fluorophenyl)-N,2-dimethylpentan-1-amine.
| Compound Name | 1-(2-bromo-3-fluorophenyl)-N,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 107893716 |
| Molecular Formula | C13H19BrFN |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-(2-bromo-3-fluorophenyl)-N,2-dimethylpentan-1-amine |
| SMILES | CCCC(C)C(NC)c1cccc(F)c1Br |
| InChI | InChI=1S/C13H19BrFN/c1-4-6-9(2)13(16-3)10-7-5-8-11(15)12(10)14/h5,7-9,13,16H,4,6H2,1-3H3 |
| InChIKey | HDLBROONAYBEFJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |