C9H18F2N2 — CID 105265151
[2,2-difluoro-1-(4-methylcyclohexyl)ethyl]hydrazine (PubChem CID 105265151) has the molecular formula C9H18F2N2 and a molecular weight of 192.25 g/mol. Its IUPAC name is [2,2-difluoro-1-(4-methylcyclohexyl)ethyl]hydrazine.
| Compound Name | [2,2-difluoro-1-(4-methylcyclohexyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265151 |
| Molecular Formula | C9H18F2N2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | [2,2-difluoro-1-(4-methylcyclohexyl)ethyl]hydrazine |
| SMILES | CC1CCC(C(NN)C(F)F)CC1 |
| InChI | InChI=1S/C9H18F2N2/c1-6-2-4-7(5-3-6)8(13-12)9(10)11/h6-9,13H,2-5,12H2,1H3 |
| InChIKey | SXAXKYAMNLPCLN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|