About formohydrazide;1-methyl-4-propan-2-ylcyclohexane
formohydrazide;1-methyl-4-propan-2-ylcyclohexane (PubChem CID 175318505) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is formohydrazide;1-methyl-4-propan-2-ylcyclohexane.
Molecular Properties
| Compound Name | formohydrazide;1-methyl-4-propan-2-ylcyclohexane |
| PubChem CID | 175318505 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | formohydrazide;1-methyl-4-propan-2-ylcyclohexane |
| SMILES | CC1CCC(C(C)C)CC1.NNC=O |
| InChI | InChI=1S/C10H20.CH4N2O/c1-8(2)10-6-4-9(3)5-7-10;2-3-1-4/h8-10H,4-7H2,1-3H3;1H,2H2,(H,3,4) |
| InChIKey | QCEOAGFUDKCAHR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formohydrazide;1-methyl-4-propan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formohydrazide;1-methyl-4-propan-2-ylcyclohexane?
The IUPAC name of formohydrazide;1-methyl-4-propan-2-ylcyclohexane (CID 175318505) is formohydrazide;1-methyl-4-propan-2-ylcyclohexane.
What is the SMILES notation for formohydrazide;1-methyl-4-propan-2-ylcyclohexane?
The canonical SMILES for formohydrazide;1-methyl-4-propan-2-ylcyclohexane is CC1CCC(C(C)C)CC1.NNC=O.
What is the InChIKey of formohydrazide;1-methyl-4-propan-2-ylcyclohexane?
The InChIKey is QCEOAGFUDKCAHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.CH4N2O/c1-8(2)10-6-4-9(3)5-7-10;2-3-1-4/h8-10H,4-7H2,1-3H3;1H,2H2,(H,3,4).
What are the key properties of formohydrazide;1-methyl-4-propan-2-ylcyclohexane?
formohydrazide;1-methyl-4-propan-2-ylcyclohexane has a molecular weight of 200.33 g/mol, XLogP of 2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formohydrazide;1-methyl-4-propan-2-ylcyclohexane is sourced from PubChem (CID 175318505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).