About N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane
N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane (PubChem CID 90040795) has the molecular formula C15H29NO
and a molecular weight of 239.40 g/mol. Its IUPAC name is N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane.
Molecular Properties
| Compound Name | N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane |
| PubChem CID | 90040795 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane |
| SMILES | CC(=O)NC1CC1.CC1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C10H20.C5H9NO/c1-8(2)10-6-4-9(3)5-7-10;1-4(7)6-5-2-3-5/h8-10H,4-7H2,1-3H3;5H,2-3H2,1H3,(H,6,7) |
| InChIKey | WXYTXDJVLWQREJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane?
The IUPAC name of N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane (CID 90040795) is N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane.
What is the SMILES notation for N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane?
The canonical SMILES for N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane is CC(=O)NC1CC1.CC1CCC(C(C)C)CC1.
What is the InChIKey of N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane?
The InChIKey is WXYTXDJVLWQREJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.C5H9NO/c1-8(2)10-6-4-9(3)5-7-10;1-4(7)6-5-2-3-5/h8-10H,4-7H2,1-3H3;5H,2-3H2,1H3,(H,6,7).
What are the key properties of N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane?
N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane has a molecular weight of 239.40 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropylacetamide;1-methyl-4-propan-2-ylcyclohexane is sourced from PubChem (CID 90040795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).