C14H27NO — CID 143490442
2-methylbut-1-ene;N-(4-methylcyclohexyl)acetamide (PubChem CID 143490442) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 2-methylbut-1-ene;N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-methylbut-1-ene;N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 143490442 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 2-methylbut-1-ene;N-(4-methylcyclohexyl)acetamide |
| SMILES | C=C(C)CC.CC(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C9H17NO.C5H10/c1-7-3-5-9(6-4-7)10-8(2)11;1-4-5(2)3/h7,9H,3-6H2,1-2H3,(H,10,11);2,4H2,1,3H3 |
| InChIKey | LHCAONAOHPEJPQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|