About carbamic acid;1-methyl-4-propan-2-ylcyclohexane
carbamic acid;1-methyl-4-propan-2-ylcyclohexane (PubChem CID 67059714) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is carbamic acid;1-methyl-4-propan-2-ylcyclohexane.
Molecular Properties
| Compound Name | carbamic acid;1-methyl-4-propan-2-ylcyclohexane |
| PubChem CID | 67059714 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | carbamic acid;1-methyl-4-propan-2-ylcyclohexane |
| SMILES | CC1CCC(C(C)C)CC1.NC(=O)O |
| InChI | InChI=1S/C10H20.CH3NO2/c1-8(2)10-6-4-9(3)5-7-10;2-1(3)4/h8-10H,4-7H2,1-3H3;2H2,(H,3,4) |
| InChIKey | LDCHNODRWFERQX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze carbamic acid;1-methyl-4-propan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;1-methyl-4-propan-2-ylcyclohexane?
The IUPAC name of carbamic acid;1-methyl-4-propan-2-ylcyclohexane (CID 67059714) is carbamic acid;1-methyl-4-propan-2-ylcyclohexane.
What is the SMILES notation for carbamic acid;1-methyl-4-propan-2-ylcyclohexane?
The canonical SMILES for carbamic acid;1-methyl-4-propan-2-ylcyclohexane is CC1CCC(C(C)C)CC1.NC(=O)O.
What is the InChIKey of carbamic acid;1-methyl-4-propan-2-ylcyclohexane?
The InChIKey is LDCHNODRWFERQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.CH3NO2/c1-8(2)10-6-4-9(3)5-7-10;2-1(3)4/h8-10H,4-7H2,1-3H3;2H2,(H,3,4).
What are the key properties of carbamic acid;1-methyl-4-propan-2-ylcyclohexane?
carbamic acid;1-methyl-4-propan-2-ylcyclohexane has a molecular weight of 201.31 g/mol, XLogP of 3.09, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;1-methyl-4-propan-2-ylcyclohexane is sourced from PubChem (CID 67059714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).