C17H35NO — CID 143679786
2,2-dimethylpropane;N-[4-(2-methylpropyl)cyclohexyl]acetamide (PubChem CID 143679786) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is 2,2-dimethylpropane;N-[4-(2-methylpropyl)cyclohexyl]acetamide.
| Compound Name | 2,2-dimethylpropane;N-[4-(2-methylpropyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 143679786 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 2,2-dimethylpropane;N-[4-(2-methylpropyl)cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(CC(C)C)CC1.CC(C)(C)C |
| InChI | InChI=1S/C12H23NO.C5H12/c1-9(2)8-11-4-6-12(7-5-11)13-10(3)14;1-5(2,3)4/h9,11-12H,4-8H2,1-3H3,(H,13,14);1-4H3 |
| InChIKey | QXGXDOHGLWAMFE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |