C11H21N3 — CID 105265714
1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)prop-2-enylhydrazine (PubChem CID 105265714) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)prop-2-enylhydrazine.
| Compound Name | 1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)prop-2-enylhydrazine |
|---|---|
| PubChem CID | 105265714 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)prop-2-enylhydrazine |
| SMILES | C=CC(NN)C1CC2CCC(C1)N2C |
| InChI | InChI=1S/C11H21N3/c1-3-11(13-12)8-6-9-4-5-10(7-8)14(9)2/h3,8-11,13H,1,4-7,12H2,2H3 |
| InChIKey | CHEQDRZMKZGBNI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|