C13H25N3 — CID 105265895
[3-methyl-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)but-2-enyl]hydrazine (PubChem CID 105265895) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is [3-methyl-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)but-2-enyl]hydrazine.
| Compound Name | [3-methyl-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)but-2-enyl]hydrazine |
|---|---|
| PubChem CID | 105265895 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | [3-methyl-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)but-2-enyl]hydrazine |
| SMILES | CC(C)=CC(NN)C1CC2CCC(C1)N2C |
| InChI | InChI=1S/C13H25N3/c1-9(2)6-13(15-14)10-7-11-4-5-12(8-10)16(11)3/h6,10-13,15H,4-5,7-8,14H2,1-3H3 |
| InChIKey | IICYDWZMAVYSBO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|