C15H26N2 — CID 143720884
10-pentyl-5,6-diazatricyclo[7.3.0.02,6]dodec-1(12)-ene (PubChem CID 143720884) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 10-pentyl-5,6-diazatricyclo[7.3.0.02,6]dodec-1(12)-ene.
| Compound Name | 10-pentyl-5,6-diazatricyclo[7.3.0.02,6]dodec-1(12)-ene |
|---|---|
| PubChem CID | 143720884 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 10-pentyl-5,6-diazatricyclo[7.3.0.02,6]dodec-1(12)-ene |
| SMILES | CCCCCC1CC=C2C1CCN1NCCC21 |
| InChI | InChI=1S/C15H26N2/c1-2-3-4-5-12-6-7-14-13(12)9-11-17-15(14)8-10-16-17/h7,12-13,15-16H,2-6,8-11H2,1H3 |
| InChIKey | OSNZCAXNJSLRLL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|